C35H56O3 — CID 118015877
2-(1-hydroxyethyl)-3,4a,5a,10,12,12a-hexamethyl-7-[2-(1-methylcyclohexyl)ethyl]-5,6,6a,7,8,9,10,10a,11a,12-decahydro-4H-tetracene-1,11-dione (PubChem CID 118015877) has the molecular formula C35H56O3 and a molecular weight of 524.83 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-3,4a,5a,10,12,12a-hexamethyl-7-[2-(1-methylcyclohexyl)ethyl]-5,6,6a,7,8,9,10,10a,11a,12-decahydro-4H-tetracene-1,11-dione.
| Compound Name | 2-(1-hydroxyethyl)-3,4a,5a,10,12,12a-hexamethyl-7-[2-(1-methylcyclohexyl)ethyl]-5,6,6a,7,8,9,10,10a,11a,12-decahydro-4H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 118015877 |
| Molecular Formula | C35H56O3 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 524.42 |
| IUPAC Name | 2-(1-hydroxyethyl)-3,4a,5a,10,12,12a-hexamethyl-7-[2-(1-methylcyclohexyl)ethyl]-5,6,6a,7,8,9,10,10a,11a,12-decahydro-4H-tetracene-1,11-dione |
| SMILES | CC1=C(C(C)O)C(=O)C2(C)C(C)C3C(=O)C4C(C)CCC(CCC5(C)CCCCC5)C4CC3(C)CC2(C)C1 |
| InChI | InChI=1S/C35H56O3/c1-21-12-13-25(14-17-32(5)15-10-9-11-16-32)26-19-33(6)20-34(7)18-22(2)27(24(4)36)31(38)35(34,8)23(3)29(33)30(37)28(21)26/h21,23-26,28-29,36H,9-20H2,1-8H3 |
| InChIKey | KTPUYGRBEXPZGV-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |