C37H56O3 — CID 118015938
2-acetyl-9-(3,4-dimethylcyclohex-3-en-1-yl)-3,4a,5a,10,12,12a-hexamethyl-7-propan-2-yl-5,6,6a,7,8,9,10,10a,11a,12-decahydro-4H-tetracene-1,11-dione (PubChem CID 118015938) has the molecular formula C37H56O3 and a molecular weight of 548.85 g/mol. Its IUPAC name is 2-acetyl-9-(3,4-dimethylcyclohex-3-en-1-yl)-3,4a,5a,10,12,12a-hexamethyl-7-propan-2-yl-5,6,6a,7,8,9,10,10a,11a,12-decahydro-4H-tetracene-1,11-dione.
| Compound Name | 2-acetyl-9-(3,4-dimethylcyclohex-3-en-1-yl)-3,4a,5a,10,12,12a-hexamethyl-7-propan-2-yl-5,6,6a,7,8,9,10,10a,11a,12-decahydro-4H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 118015938 |
| Molecular Formula | C37H56O3 |
| Molecular Weight | 548.85 g/mol |
| Exact Mass | 548.42 |
| IUPAC Name | 2-acetyl-9-(3,4-dimethylcyclohex-3-en-1-yl)-3,4a,5a,10,12,12a-hexamethyl-7-propan-2-yl-5,6,6a,7,8,9,10,10a,11a,12-decahydro-4H-tetracene-1,11-dione |
| SMILES | CC(=O)C1=C(C)CC2(C)CC3(C)CC4C(C(C)C)CC(C5CCC(C)=C(C)C5)C(C)C4C(=O)C3C(C)C2(C)C1=O |
| InChI | InChI=1S/C37H56O3/c1-19(2)27-15-28(26-13-12-20(3)21(4)14-26)23(6)31-29(27)17-35(9)18-36(10)16-22(5)30(25(8)38)34(40)37(36,11)24(7)32(35)33(31)39/h19,23-24,26-29,31-32H,12-18H2,1-11H3 |
| InChIKey | MGFPLLUWXCRSKZ-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.85 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|