C34H48O4 — CID 118016011
2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-(2-oxopentyl)-7-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-1,11-dione (PubChem CID 118016011) has the molecular formula C34H48O4 and a molecular weight of 520.75 g/mol. Its IUPAC name is 2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-(2-oxopentyl)-7-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-1,11-dione.
| Compound Name | 2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-(2-oxopentyl)-7-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 118016011 |
| Molecular Formula | C34H48O4 |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | 2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-(2-oxopentyl)-7-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-1,11-dione |
| SMILES | CCCC(=O)Cc1cc(C(C)C)c2c(c1C)C(=O)C1C(C)C3(C)C(=O)C(C(C)=O)C(C)CC3(C)CC1(C)C2 |
| InChI | InChI=1S/C34H48O4/c1-11-12-24(36)13-23-14-25(18(2)3)26-16-32(8)17-33(9)15-19(4)27(22(7)35)31(38)34(33,10)21(6)29(32)30(37)28(26)20(23)5/h14,18-19,21,27,29H,11-13,15-17H2,1-10H3 |
| InChIKey | TYQKAGRBEXHJAF-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|