C9H3BrF3N3OS — CID 118016459
N-(5-bromo-1,3,4-thiadiazol-2-yl)-2,3,6-trifluorobenzamide (PubChem CID 118016459) has the molecular formula C9H3BrF3N3OS and a molecular weight of 338.11 g/mol. Its IUPAC name is N-(5-bromo-1,3,4-thiadiazol-2-yl)-2,3,6-trifluorobenzamide.
| Compound Name | N-(5-bromo-1,3,4-thiadiazol-2-yl)-2,3,6-trifluorobenzamide |
|---|---|
| PubChem CID | 118016459 |
| Molecular Formula | C9H3BrF3N3OS |
| Molecular Weight | 338.11 g/mol |
| Exact Mass | 336.91 |
| IUPAC Name | N-(5-bromo-1,3,4-thiadiazol-2-yl)-2,3,6-trifluorobenzamide |
| SMILES | O=C(Nc1nnc(Br)s1)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C9H3BrF3N3OS/c10-8-15-16-9(18-8)14-7(17)5-3(11)1-2-4(12)6(5)13/h1-2H,(H,14,16,17) |
| InChIKey | FBWUQWVKYNMAHO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.11 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|