C31H42N8O2 — CID 11801648
6-[[1-[4,6-bis(prop-2-enylamino)-1,3,5-triazin-2-yl]piperidin-4-yl]amino]-2-(3,4-dimethoxyphenyl)-2-propan-2-ylhex-4-ynenitrile (PubChem CID 11801648) has the molecular formula C31H42N8O2 and a molecular weight of 558.73 g/mol. Its IUPAC name is 6-[[1-[4,6-bis(prop-2-enylamino)-1,3,5-triazin-2-yl]piperidin-4-yl]amino]-2-(3,4-dimethoxyphenyl)-2-propan-2-ylhex-4-ynenitrile.
| Compound Name | 6-[[1-[4,6-bis(prop-2-enylamino)-1,3,5-triazin-2-yl]piperidin-4-yl]amino]-2-(3,4-dimethoxyphenyl)-2-propan-2-ylhex-4-ynenitrile |
|---|---|
| PubChem CID | 11801648 |
| Molecular Formula | C31H42N8O2 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | 6-[[1-[4,6-bis(prop-2-enylamino)-1,3,5-triazin-2-yl]piperidin-4-yl]amino]-2-(3,4-dimethoxyphenyl)-2-propan-2-ylhex-4-ynenitrile |
| SMILES | C=CCNc1nc(NCC=C)nc(N2CCC(NCC#CCC(C#N)(c3ccc(OC)c(OC)c3)C(C)C)CC2)n1 |
| InChI | InChI=1S/C31H42N8O2/c1-7-16-34-28-36-29(35-17-8-2)38-30(37-28)39-19-13-25(14-20-39)33-18-10-9-15-31(22-32,23(3)4)24-11-12-26(40-5)27(21-24)41-6/h7-8,11-12,21,23,25,33H,1-2,13-20H2,3-6H3,(H2,34,35,36,37,38) |
| InChIKey | SHHTUPUZYINCHV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|