C28H44N2O12 — CID 118017065
N-phenyl-N',N'-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]hexanediamide (PubChem CID 118017065) has the molecular formula C28H44N2O12 and a molecular weight of 600.66 g/mol. Its IUPAC name is N-phenyl-N',N'-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]hexanediamide.
| Compound Name | N-phenyl-N',N'-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]hexanediamide |
|---|---|
| PubChem CID | 118017065 |
| Molecular Formula | C28H44N2O12 |
| Molecular Weight | 600.66 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | N-phenyl-N',N'-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]hexanediamide |
| SMILES | C[C@@H]1O[C@@H](OCCN(CCO[C@@H]2O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]2O)C(=O)CCCCC(=O)Nc2ccccc2)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H44N2O12/c1-16-21(33)23(35)25(37)27(41-16)39-14-12-30(13-15-40-28-26(38)24(36)22(34)17(2)42-28)20(32)11-7-6-10-19(31)29-18-8-4-3-5-9-18/h3-5,8-9,16-17,21-28,33-38H,6-7,10-15H2,1-2H3,(H,29,31)/t16-,17-,21+,22+,23+,24+,25-,26-,27+,28+/m0/s1 |
| InChIKey | GXYKGKVQEUJVLF-NHKUEAMKSA-N |
| XLogP | -1.30 |
| TPSA | 207.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.66 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|