About 2-amino-3-[2,5-dioxo-1-[3-oxo-3-(2-propoxyethylamino)propyl]pyrrolidin-3-yl]sulfanylpropanoic acid
2-amino-3-[2,5-dioxo-1-[3-oxo-3-(2-propoxyethylamino)propyl]pyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 118017222) has the molecular formula C15H25N3O6S
and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-amino-3-[2,5-dioxo-1-[3-oxo-3-(2-propoxyethylamino)propyl]pyrrolidin-3-yl]sulfanylpropanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-[2,5-dioxo-1-[3-oxo-3-(2-propoxyethylamino)propyl]pyrrolidin-3-yl]sulfanylpropanoic acid |
| PubChem CID | 118017222 |
| Molecular Formula | C15H25N3O6S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-amino-3-[2,5-dioxo-1-[3-oxo-3-(2-propoxyethylamino)propyl]pyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | CCCOCCNC(=O)CCN1C(=O)CC(SCC(N)C(=O)O)C1=O |
| InChI | InChI=1S/C15H25N3O6S/c1-2-6-24-7-4-17-12(19)3-5-18-13(20)8-11(14(18)21)25-9-10(16)15(22)23/h10-11H,2-9,16H2,1H3,(H,17,19)(H,22,23) |
| InChIKey | PJTHMYKMRWWLEO-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-[2,5-dioxo-1-[3-oxo-3-(2-propoxyethylamino)propyl]pyrrolidin-3-yl]sulfanylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[2,5-dioxo-1-[3-oxo-3-(2-propoxyethylamino)propyl]pyrrolidin-3-yl]sulfanylpropanoic acid?
The IUPAC name of 2-amino-3-[2,5-dioxo-1-[3-oxo-3-(2-propoxyethylamino)propyl]pyrrolidin-3-yl]sulfanylpropanoic acid (CID 118017222) is 2-amino-3-[2,5-dioxo-1-[3-oxo-3-(2-propoxyethylamino)propyl]pyrrolidin-3-yl]sulfanylpropanoic acid.
What is the SMILES notation for 2-amino-3-[2,5-dioxo-1-[3-oxo-3-(2-propoxyethylamino)propyl]pyrrolidin-3-yl]sulfanylpropanoic acid?
The canonical SMILES for 2-amino-3-[2,5-dioxo-1-[3-oxo-3-(2-propoxyethylamino)propyl]pyrrolidin-3-yl]sulfanylpropanoic acid is CCCOCCNC(=O)CCN1C(=O)CC(SCC(N)C(=O)O)C1=O.
What is the InChIKey of 2-amino-3-[2,5-dioxo-1-[3-oxo-3-(2-propoxyethylamino)propyl]pyrrolidin-3-yl]sulfanylpropanoic acid?
The InChIKey is PJTHMYKMRWWLEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O6S/c1-2-6-24-7-4-17-12(19)3-5-18-13(20)8-11(14(18)21)25-9-10(16)15(22)23/h10-11H,2-9,16H2,1H3,(H,17,19)(H,22,23).
What are the key properties of 2-amino-3-[2,5-dioxo-1-[3-oxo-3-(2-propoxyethylamino)propyl]pyrrolidin-3-yl]sulfanylpropanoic acid?
2-amino-3-[2,5-dioxo-1-[3-oxo-3-(2-propoxyethylamino)propyl]pyrrolidin-3-yl]sulfanylpropanoic acid has a molecular weight of 375.45 g/mol, XLogP of -0.81, 12 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[2,5-dioxo-1-[3-oxo-3-(2-propoxyethylamino)propyl]pyrrolidin-3-yl]sulfanylpropanoic acid is sourced from PubChem (CID 118017222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).