C27H30N4O8S2 — CID 11801761
(3S,6R,11R,14S)-3-(hydroxymethyl)-6-[[4-(4-hydroxyphenyl)benzoyl]amino]-2,5,13-trioxo-8,9-dithia-1,4,12-triazabicyclo[12.3.0]heptadecane-11-carboxylic acid (PubChem CID 11801761) has the molecular formula C27H30N4O8S2 and a molecular weight of 602.69 g/mol. Its IUPAC name is (3S,6R,11R,14S)-3-(hydroxymethyl)-6-[[4-(4-hydroxyphenyl)benzoyl]amino]-2,5,13-trioxo-8,9-dithia-1,4,12-triazabicyclo[12.3.0]heptadecane-11-carboxylic acid.
| Compound Name | (3S,6R,11R,14S)-3-(hydroxymethyl)-6-[[4-(4-hydroxyphenyl)benzoyl]amino]-2,5,13-trioxo-8,9-dithia-1,4,12-triazabicyclo[12.3.0]heptadecane-11-carboxylic acid |
|---|---|
| PubChem CID | 11801761 |
| Molecular Formula | C27H30N4O8S2 |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | (3S,6R,11R,14S)-3-(hydroxymethyl)-6-[[4-(4-hydroxyphenyl)benzoyl]amino]-2,5,13-trioxo-8,9-dithia-1,4,12-triazabicyclo[12.3.0]heptadecane-11-carboxylic acid |
| SMILES | O=C(N[C@H]1CSSC[C@@H](C(=O)O)NC(=O)[C@@H]2CCCN2C(=O)[C@H](CO)NC1=O)c1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C27H30N4O8S2/c32-12-19-26(37)31-11-1-2-22(31)25(36)30-21(27(38)39)14-41-40-13-20(24(35)28-19)29-23(34)17-5-3-15(4-6-17)16-7-9-18(33)10-8-16/h3-10,19-22,32-33H,1-2,11-14H2,(H,28,35)(H,29,34)(H,30,36)(H,38,39)/t19-,20-,21-,22-/m0/s1 |
| InChIKey | WUSXZUZLWYSGJE-CMOCDZPBSA-N |
| XLogP | 0.59 |
| TPSA | 185.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|