C23H28N6O2 — CID 118017650
(E)-4-(dimethylamino)-1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-4,6,7,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-yl]but-2-en-1-one (PubChem CID 118017650) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-4,6,7,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-4,6,7,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 118017650 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-4,6,7,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-yl]but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CCc2c(cn3ncnc(N[C@H](CO)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C23H28N6O2/c1-27(2)11-6-9-21(31)28-12-10-19-18(13-28)14-29-22(19)23(24-16-25-29)26-20(15-30)17-7-4-3-5-8-17/h3-9,14,16,20,30H,10-13,15H2,1-2H3,(H,24,25,26)/b9-6+/t20-/m1/s1 |
| InChIKey | FCZFUZMVUNKZJX-AQDCRGGLSA-N |
| XLogP | 1.88 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|