C30H25Cl3O8 — CID 118018170
[(3S,5S,6S)-4,5-dibenzoyloxy-2-methyl-6-(3,3,3-trichloroprop-1-en-2-yloxy)oxan-3-yl] benzoate (PubChem CID 118018170) has the molecular formula C30H25Cl3O8 and a molecular weight of 619.88 g/mol. Its IUPAC name is [(3S,5S,6S)-4,5-dibenzoyloxy-2-methyl-6-(3,3,3-trichloroprop-1-en-2-yloxy)oxan-3-yl] benzoate.
| Compound Name | [(3S,5S,6S)-4,5-dibenzoyloxy-2-methyl-6-(3,3,3-trichloroprop-1-en-2-yloxy)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 118018170 |
| Molecular Formula | C30H25Cl3O8 |
| Molecular Weight | 619.88 g/mol |
| Exact Mass | 618.06 |
| IUPAC Name | [(3S,5S,6S)-4,5-dibenzoyloxy-2-methyl-6-(3,3,3-trichloroprop-1-en-2-yloxy)oxan-3-yl] benzoate |
| SMILES | C=C(O[C@@H]1OC(C)[C@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C30H25Cl3O8/c1-18-23(39-26(34)20-12-6-3-7-13-20)24(40-27(35)21-14-8-4-9-15-21)25(29(37-18)38-19(2)30(31,32)33)41-28(36)22-16-10-5-11-17-22/h3-18,23-25,29H,2H2,1H3/t18?,23-,24?,25-,29-/m0/s1 |
| InChIKey | RBHRWHHXZYVRCI-PZRZXUEASA-N |
| XLogP | 6.31 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.88 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|