C16H23FO2 — CID 118018322
methyl (3S,4R,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-3,6-dimethylcyclohexene-1-carboxylate (PubChem CID 118018322) has the molecular formula C16H23FO2 and a molecular weight of 266.36 g/mol. Its IUPAC name is methyl (3S,4R,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-3,6-dimethylcyclohexene-1-carboxylate.
| Compound Name | methyl (3S,4R,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-3,6-dimethylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 118018322 |
| Molecular Formula | C16H23FO2 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | methyl (3S,4R,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-3,6-dimethylcyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C[C@H](C)[C@H](C2=CC[C@H](F)CC2)C[C@@H]1C |
| InChI | InChI=1S/C16H23FO2/c1-10-9-15(16(18)19-3)11(2)8-14(10)12-4-6-13(17)7-5-12/h4,9-11,13-14H,5-8H2,1-3H3/t10-,11-,13-,14+/m0/s1 |
| InChIKey | APYPGCSZNYBUBV-AUZPSNTRSA-N |
| XLogP | 3.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|