About 1-[(4S,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-6-propan-2-yloxycyclohexen-1-yl]propan-1-one
1-[(4S,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-6-propan-2-yloxycyclohexen-1-yl]propan-1-one (PubChem CID 118018398) has the molecular formula C18H27FO2
and a molecular weight of 294.41 g/mol. Its IUPAC name is 1-[(4S,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-6-propan-2-yloxycyclohexen-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[(4S,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-6-propan-2-yloxycyclohexen-1-yl]propan-1-one |
| PubChem CID | 118018398 |
| Molecular Formula | C18H27FO2 |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 1-[(4S,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-6-propan-2-yloxycyclohexen-1-yl]propan-1-one |
| SMILES | CCC(=O)C1=CC[C@H](C2=CC[C@H](F)CC2)C[C@@H]1OC(C)C |
| InChI | InChI=1S/C18H27FO2/c1-4-17(20)16-10-7-14(11-18(16)21-12(2)3)13-5-8-15(19)9-6-13/h5,10,12,14-15,18H,4,6-9,11H2,1-3H3/t14-,15-,18-/m0/s1 |
| InChIKey | MXVKTDCRSQPHML-MPGHIAIKSA-N |
| XLogP | 4.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4S,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-6-propan-2-yloxycyclohexen-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4S,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-6-propan-2-yloxycyclohexen-1-yl]propan-1-one?
The IUPAC name of 1-[(4S,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-6-propan-2-yloxycyclohexen-1-yl]propan-1-one (CID 118018398) is 1-[(4S,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-6-propan-2-yloxycyclohexen-1-yl]propan-1-one.
What is the SMILES notation for 1-[(4S,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-6-propan-2-yloxycyclohexen-1-yl]propan-1-one?
The canonical SMILES for 1-[(4S,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-6-propan-2-yloxycyclohexen-1-yl]propan-1-one is CCC(=O)C1=CC[C@H](C2=CC[C@H](F)CC2)C[C@@H]1OC(C)C.
What is the InChIKey of 1-[(4S,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-6-propan-2-yloxycyclohexen-1-yl]propan-1-one?
The InChIKey is MXVKTDCRSQPHML-MPGHIAIKSA-N. The full InChI is InChI=1S/C18H27FO2/c1-4-17(20)16-10-7-14(11-18(16)21-12(2)3)13-5-8-15(19)9-6-13/h5,10,12,14-15,18H,4,6-9,11H2,1-3H3/t14-,15-,18-/m0/s1.
What are the key properties of 1-[(4S,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-6-propan-2-yloxycyclohexen-1-yl]propan-1-one?
1-[(4S,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-6-propan-2-yloxycyclohexen-1-yl]propan-1-one has a molecular weight of 294.41 g/mol, XLogP of 4.54, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4S,6S)-4-[(4R)-4-fluorocyclohexen-1-yl]-6-propan-2-yloxycyclohexen-1-yl]propan-1-one is sourced from PubChem (CID 118018398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).