C13H25FN2 — CID 118018657
(1R,2S)-1-[(4R)-4-fluorocyclohexen-1-yl]-2,4-dimethylpentane-1,4-diamine (PubChem CID 118018657) has the molecular formula C13H25FN2 and a molecular weight of 228.35 g/mol. Its IUPAC name is (1R,2S)-1-[(4R)-4-fluorocyclohexen-1-yl]-2,4-dimethylpentane-1,4-diamine.
| Compound Name | (1R,2S)-1-[(4R)-4-fluorocyclohexen-1-yl]-2,4-dimethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 118018657 |
| Molecular Formula | C13H25FN2 |
| Molecular Weight | 228.35 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | (1R,2S)-1-[(4R)-4-fluorocyclohexen-1-yl]-2,4-dimethylpentane-1,4-diamine |
| SMILES | C[C@@H](CC(C)(C)N)[C@@H](N)C1=CC[C@H](F)CC1 |
| InChI | InChI=1S/C13H25FN2/c1-9(8-13(2,3)16)12(15)10-4-6-11(14)7-5-10/h4,9,11-12H,5-8,15-16H2,1-3H3/t9-,11-,12+/m0/s1 |
| InChIKey | MHKKUURCOORSCM-ZMLRMANQSA-N |
| XLogP | 2.53 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|