C26H23ClFN5O2 — CID 118018849
1-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)-2-(methylamino)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 118018849) has the molecular formula C26H23ClFN5O2 and a molecular weight of 491.95 g/mol. Its IUPAC name is 1-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)-2-(methylamino)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)-2-(methylamino)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118018849 |
| Molecular Formula | C26H23ClFN5O2 |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 1-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)-2-(methylamino)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nc(NC)nc3c(F)c(-c4cc(O)cc5ccccc45)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C26H23ClFN5O2/c1-3-21(35)32-8-10-33(11-9-32)25-19-14-20(27)22(23(28)24(19)30-26(29-2)31-25)18-13-16(34)12-15-6-4-5-7-17(15)18/h3-7,12-14,34H,1,8-11H2,2H3,(H,29,30,31) |
| InChIKey | RPXCNCRDXKTEHQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|