C26H22ClFN4O2 — CID 118019032
(E)-1-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]piperazin-1-yl]but-2-en-1-one (PubChem CID 118019032) has the molecular formula C26H22ClFN4O2 and a molecular weight of 476.94 g/mol. Its IUPAC name is (E)-1-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]piperazin-1-yl]but-2-en-1-one.
| Compound Name | (E)-1-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]piperazin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 118019032 |
| Molecular Formula | C26H22ClFN4O2 |
| Molecular Weight | 476.94 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (E)-1-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]piperazin-1-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1CCN(c2ncnc3c(F)c(-c4cc(O)cc5ccccc45)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C26H22ClFN4O2/c1-2-5-22(34)31-8-10-32(11-9-31)26-20-14-21(27)23(24(28)25(20)29-15-30-26)19-13-17(33)12-16-6-3-4-7-18(16)19/h2-7,12-15,33H,8-11H2,1H3/b5-2+ |
| InChIKey | VRMBATZPDMJHEG-GORDUTHDSA-N |
| XLogP | 5.17 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.94 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|