C22H17F5N4O — CID 118019050
1-[4-[7-(2,4-difluorophenyl)-6-(trifluoromethyl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 118019050) has the molecular formula C22H17F5N4O and a molecular weight of 448.40 g/mol. Its IUPAC name is 1-[4-[7-(2,4-difluorophenyl)-6-(trifluoromethyl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-(2,4-difluorophenyl)-6-(trifluoromethyl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118019050 |
| Molecular Formula | C22H17F5N4O |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 1-[4-[7-(2,4-difluorophenyl)-6-(trifluoromethyl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3cc(-c4ccc(F)cc4F)c(C(F)(F)F)cc23)CC1 |
| InChI | InChI=1S/C22H17F5N4O/c1-2-20(32)30-5-7-31(8-6-30)21-16-10-17(22(25,26)27)15(11-19(16)28-12-29-21)14-4-3-13(23)9-18(14)24/h2-4,9-12H,1,5-8H2 |
| InChIKey | GXLLVQPUXRMPLE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|