C29H16F10N2O2 — CID 11801916
[5-[[5-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-phenylmethyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanol (PubChem CID 11801916) has the molecular formula C29H16F10N2O2 and a molecular weight of 614.44 g/mol. Its IUPAC name is [5-[[5-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-phenylmethyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanol.
| Compound Name | [5-[[5-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-phenylmethyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanol |
|---|---|
| PubChem CID | 11801916 |
| Molecular Formula | C29H16F10N2O2 |
| Molecular Weight | 614.44 g/mol |
| Exact Mass | 614.11 |
| IUPAC Name | [5-[[5-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-phenylmethyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanol |
| SMILES | OC(c1ccc(C(c2ccccc2)c2ccc(C(O)c3c(F)c(F)c(F)c(F)c3F)[nH]2)[nH]1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C29H16F10N2O2/c30-18-16(19(31)23(35)26(38)22(18)34)28(42)13-8-6-11(40-13)15(10-4-2-1-3-5-10)12-7-9-14(41-12)29(43)17-20(32)24(36)27(39)25(37)21(17)33/h1-9,15,28-29,40-43H |
| InChIKey | QJDAAXVJEIXJQP-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.44 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|