About (2E,4E)-6-imino-4-(trifluoromethyl)hexa-2,4-dien-2-amine
(2E,4E)-6-imino-4-(trifluoromethyl)hexa-2,4-dien-2-amine (PubChem CID 118019234) has the molecular formula C7H9F3N2
and a molecular weight of 178.16 g/mol. Its IUPAC name is (2E,4E)-6-imino-4-(trifluoromethyl)hexa-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2E,4E)-6-imino-4-(trifluoromethyl)hexa-2,4-dien-2-amine |
| PubChem CID | 118019234 |
| Molecular Formula | C7H9F3N2 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (2E,4E)-6-imino-4-(trifluoromethyl)hexa-2,4-dien-2-amine |
| SMILES | [H]/N=C/C=C(\C=C(/C)N)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2/c1-5(12)4-6(2-3-11)7(8,9)10/h2-4,11H,12H2,1H3/b5-4+,6-2+,11-3+ |
| InChIKey | BPYLEKPPRAWMPF-PJEBCQTRSA-N |
| XLogP | 1.99 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-6-imino-4-(trifluoromethyl)hexa-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-6-imino-4-(trifluoromethyl)hexa-2,4-dien-2-amine?
The IUPAC name of (2E,4E)-6-imino-4-(trifluoromethyl)hexa-2,4-dien-2-amine (CID 118019234) is (2E,4E)-6-imino-4-(trifluoromethyl)hexa-2,4-dien-2-amine.
What is the SMILES notation for (2E,4E)-6-imino-4-(trifluoromethyl)hexa-2,4-dien-2-amine?
The canonical SMILES for (2E,4E)-6-imino-4-(trifluoromethyl)hexa-2,4-dien-2-amine is [H]/N=C/C=C(\C=C(/C)N)C(F)(F)F.
What is the InChIKey of (2E,4E)-6-imino-4-(trifluoromethyl)hexa-2,4-dien-2-amine?
The InChIKey is BPYLEKPPRAWMPF-PJEBCQTRSA-N. The full InChI is InChI=1S/C7H9F3N2/c1-5(12)4-6(2-3-11)7(8,9)10/h2-4,11H,12H2,1H3/b5-4+,6-2+,11-3+.
What are the key properties of (2E,4E)-6-imino-4-(trifluoromethyl)hexa-2,4-dien-2-amine?
(2E,4E)-6-imino-4-(trifluoromethyl)hexa-2,4-dien-2-amine has a molecular weight of 178.16 g/mol, XLogP of 1.99, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-6-imino-4-(trifluoromethyl)hexa-2,4-dien-2-amine is sourced from PubChem (CID 118019234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).