C8H12F2N2 — CID 118019248
(2E,4E)-4-(1,1-difluoroethyl)-6-iminohexa-2,4-dien-2-amine (PubChem CID 118019248) has the molecular formula C8H12F2N2 and a molecular weight of 174.19 g/mol. Its IUPAC name is (2E,4E)-4-(1,1-difluoroethyl)-6-iminohexa-2,4-dien-2-amine.
| Compound Name | (2E,4E)-4-(1,1-difluoroethyl)-6-iminohexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 118019248 |
| Molecular Formula | C8H12F2N2 |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (2E,4E)-4-(1,1-difluoroethyl)-6-iminohexa-2,4-dien-2-amine |
| SMILES | [H]/N=C/C=C(\C=C(/C)N)C(C)(F)F |
| InChI | InChI=1S/C8H12F2N2/c1-6(12)5-7(3-4-11)8(2,9)10/h3-5,11H,12H2,1-2H3/b6-5+,7-3+,11-4+ |
| InChIKey | DWJSBVORSFQXJH-HUYNODJPSA-N |
| XLogP | 2.08 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|