C13H14F5N3O3 — CID 118019314
5-ethoxy-4-hydroxy-1-methyl-3-[4-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]imidazolidin-2-one (PubChem CID 118019314) has the molecular formula C13H14F5N3O3 and a molecular weight of 355.26 g/mol. Its IUPAC name is 5-ethoxy-4-hydroxy-1-methyl-3-[4-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]imidazolidin-2-one.
| Compound Name | 5-ethoxy-4-hydroxy-1-methyl-3-[4-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 118019314 |
| Molecular Formula | C13H14F5N3O3 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 5-ethoxy-4-hydroxy-1-methyl-3-[4-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]imidazolidin-2-one |
| SMILES | CCOC1C(O)N(c2cc(C(F)(F)C(F)(F)F)ccn2)C(=O)N1C |
| InChI | InChI=1S/C13H14F5N3O3/c1-3-24-10-9(22)21(11(23)20(10)2)8-6-7(4-5-19-8)12(14,15)13(16,17)18/h4-6,9-10,22H,3H2,1-2H3 |
| InChIKey | URYGPEWDJUZAEB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|