C20H14F4N2O2 — CID 118019361
(4R,5R)-4-[5-[2-(3,3-difluorocyclobutyl)ethynyl]-3-pyridinyl]-5-(2,4-difluorophenyl)-1,3-oxazolidin-2-one (PubChem CID 118019361) has the molecular formula C20H14F4N2O2 and a molecular weight of 390.34 g/mol. Its IUPAC name is (4R,5R)-4-[5-[2-(3,3-difluorocyclobutyl)ethynyl]-3-pyridinyl]-5-(2,4-difluorophenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-4-[5-[2-(3,3-difluorocyclobutyl)ethynyl]-3-pyridinyl]-5-(2,4-difluorophenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 118019361 |
| Molecular Formula | C20H14F4N2O2 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (4R,5R)-4-[5-[2-(3,3-difluorocyclobutyl)ethynyl]-3-pyridinyl]-5-(2,4-difluorophenyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@H](c2cncc(C#CC3CC(F)(F)C3)c2)[C@@H](c2ccc(F)cc2F)O1 |
| InChI | InChI=1S/C20H14F4N2O2/c21-14-3-4-15(16(22)6-14)18-17(26-19(27)28-18)13-5-11(9-25-10-13)1-2-12-7-20(23,24)8-12/h3-6,9-10,12,17-18H,7-8H2,(H,26,27)/t17-,18-/m1/s1 |
| InChIKey | XMHKNZSVBBBYCC-QZTJIDSGSA-N |
| XLogP | 4.28 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|