About 1-O-benzyl 2-O-ethyl (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylate
1-O-benzyl 2-O-ethyl (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylate (PubChem CID 118019907) has the molecular formula C16H20FNO4
and a molecular weight of 309.34 g/mol. Its IUPAC name is 1-O-benzyl 2-O-ethyl (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-benzyl 2-O-ethyl (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylate |
| PubChem CID | 118019907 |
| Molecular Formula | C16H20FNO4 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1-O-benzyl 2-O-ethyl (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(C)C(F)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H20FNO4/c1-3-21-15(19)14-11(2)13(17)9-18(14)16(20)22-10-12-7-5-4-6-8-12/h4-8,11,13-14H,3,9-10H2,1-2H3/t11?,13?,14-/m0/s1 |
| InChIKey | NEKBJIIMSWMHCN-UBHUBRDASA-N |
| XLogP | 2.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-O-benzyl 2-O-ethyl (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-benzyl 2-O-ethyl (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylate?
The IUPAC name of 1-O-benzyl 2-O-ethyl (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylate (CID 118019907) is 1-O-benzyl 2-O-ethyl (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for 1-O-benzyl 2-O-ethyl (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylate?
The canonical SMILES for 1-O-benzyl 2-O-ethyl (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylate is CCOC(=O)[C@@H]1C(C)C(F)CN1C(=O)OCc1ccccc1.
What is the InChIKey of 1-O-benzyl 2-O-ethyl (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylate?
The InChIKey is NEKBJIIMSWMHCN-UBHUBRDASA-N. The full InChI is InChI=1S/C16H20FNO4/c1-3-21-15(19)14-11(2)13(17)9-18(14)16(20)22-10-12-7-5-4-6-8-12/h4-8,11,13-14H,3,9-10H2,1-2H3/t11?,13?,14-/m0/s1.
What are the key properties of 1-O-benzyl 2-O-ethyl (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylate?
1-O-benzyl 2-O-ethyl (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylate has a molecular weight of 309.34 g/mol, XLogP of 2.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-benzyl 2-O-ethyl (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 118019907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).