C64H42N4 — CID 118020165
1-(6,9-diphenylcarbazol-3-yl)-8-(2,6-diphenylpyrimidin-4-yl)-3,6-diphenyl-9H-carbazole (PubChem CID 118020165) has the molecular formula C64H42N4 and a molecular weight of 867.07 g/mol. Its IUPAC name is 1-(6,9-diphenylcarbazol-3-yl)-8-(2,6-diphenylpyrimidin-4-yl)-3,6-diphenyl-9H-carbazole.
| Compound Name | 1-(6,9-diphenylcarbazol-3-yl)-8-(2,6-diphenylpyrimidin-4-yl)-3,6-diphenyl-9H-carbazole |
|---|---|
| PubChem CID | 118020165 |
| Molecular Formula | C64H42N4 |
| Molecular Weight | 867.07 g/mol |
| Exact Mass | 866.34 |
| IUPAC Name | 1-(6,9-diphenylcarbazol-3-yl)-8-(2,6-diphenylpyrimidin-4-yl)-3,6-diphenyl-9H-carbazole |
| SMILES | c1ccc(-c2cc(-c3ccc4c(c3)c3cc(-c5ccccc5)ccc3n4-c3ccccc3)c3[nH]c4c(-c5cc(-c6ccccc6)nc(-c6ccccc6)n5)cc(-c5ccccc5)cc4c3c2)cc1 |
| InChI | InChI=1S/C64H42N4/c1-7-19-42(20-8-1)47-31-33-60-53(35-47)54-36-48(32-34-61(54)68(60)51-29-17-6-18-30-51)52-37-49(43-21-9-2-10-22-43)38-55-56-39-50(44-23-11-3-12-24-44)40-57(63(56)67-62(52)55)59-41-58(45-25-13-4-14-26-45)65-64(66-59)46-27-15-5-16-28-46/h1-41,67H |
| InChIKey | RDUUXIATWOXLAI-UHFFFAOYSA-N |
| XLogP | 16.88 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.07 |
| LogP ≤ 5 | 16.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |