C15H16N6O2 — CID 118020403
[5-[1-(5-cyano-2-pyridinyl)piperidin-4-yl]-1H-pyrazol-3-yl]carbamic acid (PubChem CID 118020403) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is [5-[1-(5-cyano-2-pyridinyl)piperidin-4-yl]-1H-pyrazol-3-yl]carbamic acid.
| Compound Name | [5-[1-(5-cyano-2-pyridinyl)piperidin-4-yl]-1H-pyrazol-3-yl]carbamic acid |
|---|---|
| PubChem CID | 118020403 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | [5-[1-(5-cyano-2-pyridinyl)piperidin-4-yl]-1H-pyrazol-3-yl]carbamic acid |
| SMILES | N#Cc1ccc(N2CCC(c3cc(NC(=O)O)n[nH]3)CC2)nc1 |
| InChI | InChI=1S/C15H16N6O2/c16-8-10-1-2-14(17-9-10)21-5-3-11(4-6-21)12-7-13(20-19-12)18-15(22)23/h1-2,7,9,11H,3-6H2,(H,22,23)(H2,18,19,20) |
| InChIKey | CTMYRZZGYOKAHP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |