C8H6F10O4S2 — CID 118020485
2,2,3,4,5-pentafluorothiolane 1,1-dioxide;2,3,3,4,4-pentafluorothiolane 1,1-dioxide (PubChem CID 118020485) has the molecular formula C8H6F10O4S2 and a molecular weight of 420.25 g/mol. Its IUPAC name is 2,2,3,4,5-pentafluorothiolane 1,1-dioxide;2,3,3,4,4-pentafluorothiolane 1,1-dioxide.
| Compound Name | 2,2,3,4,5-pentafluorothiolane 1,1-dioxide;2,3,3,4,4-pentafluorothiolane 1,1-dioxide |
|---|---|
| PubChem CID | 118020485 |
| Molecular Formula | C8H6F10O4S2 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 419.95 |
| IUPAC Name | 2,2,3,4,5-pentafluorothiolane 1,1-dioxide;2,3,3,4,4-pentafluorothiolane 1,1-dioxide |
| SMILES | O=S1(=O)C(F)C(F)C(F)C1(F)F.O=S1(=O)CC(F)(F)C(F)(F)C1F |
| InChI | InChI=1S/2C4H3F5O2S/c5-2-4(8,9)3(6,7)1-12(2,10)11;5-1-2(6)4(8,9)12(10,11)3(1)7/h2H,1H2;1-3H |
| InChIKey | BLZZEXGSKYCGFG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|