C21H19F5N4O4 — CID 118020731
2,2-dimethyl-3-[[5-[4-[3-(2,2,3,3,3-pentafluoropropoxy)-1H-1,2,4-triazol-5-yl]phenyl]-2-pyridinyl]oxy]propanoic acid (PubChem CID 118020731) has the molecular formula C21H19F5N4O4 and a molecular weight of 486.40 g/mol. Its IUPAC name is 2,2-dimethyl-3-[[5-[4-[3-(2,2,3,3,3-pentafluoropropoxy)-1H-1,2,4-triazol-5-yl]phenyl]-2-pyridinyl]oxy]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[[5-[4-[3-(2,2,3,3,3-pentafluoropropoxy)-1H-1,2,4-triazol-5-yl]phenyl]-2-pyridinyl]oxy]propanoic acid |
|---|---|
| PubChem CID | 118020731 |
| Molecular Formula | C21H19F5N4O4 |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 2,2-dimethyl-3-[[5-[4-[3-(2,2,3,3,3-pentafluoropropoxy)-1H-1,2,4-triazol-5-yl]phenyl]-2-pyridinyl]oxy]propanoic acid |
| SMILES | CC(C)(COc1ccc(-c2ccc(-c3nc(OCC(F)(F)C(F)(F)F)n[nH]3)cc2)cn1)C(=O)O |
| InChI | InChI=1S/C21H19F5N4O4/c1-19(2,17(31)32)10-33-15-8-7-14(9-27-15)12-3-5-13(6-4-12)16-28-18(30-29-16)34-11-20(22,23)21(24,25)26/h3-9H,10-11H2,1-2H3,(H,31,32)(H,28,29,30) |
| InChIKey | YULXTCQNCMAARH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|