About 4-methyl-2-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate
4-methyl-2-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate (PubChem CID 118020827) has the molecular formula C30H35N2O3+
and a molecular weight of 471.62 g/mol. Its IUPAC name is 4-methyl-2-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate.
Molecular Properties
| Compound Name | 4-methyl-2-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate |
| PubChem CID | 118020827 |
| Molecular Formula | C30H35N2O3+ |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 4-methyl-2-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate |
| SMILES | CC(=O)OC1C[N+]2(CC(=O)c3ccccc3)CCC1CC2.Cc1ccc(N)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C17H22NO3.C13H13N/c1-13(19)21-17-12-18(9-7-15(17)8-10-18)11-16(20)14-5-3-2-4-6-14;1-10-7-8-13(14)12(9-10)11-5-3-2-4-6-11/h2-6,15,17H,7-12H2,1H3;2-9H,14H2,1H3/q+1; |
| InChIKey | GHGOVDFOVJJPRT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate?
The IUPAC name of 4-methyl-2-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate (CID 118020827) is 4-methyl-2-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate.
What is the SMILES notation for 4-methyl-2-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate?
The canonical SMILES for 4-methyl-2-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate is CC(=O)OC1C[N+]2(CC(=O)c3ccccc3)CCC1CC2.Cc1ccc(N)c(-c2ccccc2)c1.
What is the InChIKey of 4-methyl-2-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate?
The InChIKey is GHGOVDFOVJJPRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22NO3.C13H13N/c1-13(19)21-17-12-18(9-7-15(17)8-10-18)11-16(20)14-5-3-2-4-6-14;1-10-7-8-13(14)12(9-10)11-5-3-2-4-6-11/h2-6,15,17H,7-12H2,1H3;2-9H,14H2,1H3/q+1;.
What are the key properties of 4-methyl-2-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate?
4-methyl-2-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate has a molecular weight of 471.62 g/mol, XLogP of 5.29, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate is sourced from PubChem (CID 118020827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).