About 5-bromo-2-(methoxymethyl)-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxine
5-bromo-2-(methoxymethyl)-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxine (PubChem CID 118021303) has the molecular formula C11H13BrO5S
and a molecular weight of 337.19 g/mol. Its IUPAC name is 5-bromo-2-(methoxymethyl)-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxine.
Molecular Properties
| Compound Name | 5-bromo-2-(methoxymethyl)-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxine |
| PubChem CID | 118021303 |
| Molecular Formula | C11H13BrO5S |
| Molecular Weight | 337.19 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 5-bromo-2-(methoxymethyl)-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxine |
| SMILES | COCC1COc2c(Br)cc(S(C)(=O)=O)cc2O1 |
| InChI | InChI=1S/C11H13BrO5S/c1-15-5-7-6-16-11-9(12)3-8(18(2,13)14)4-10(11)17-7/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | XAIYDNAGQAPOHU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-2-(methoxymethyl)-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(methoxymethyl)-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxine?
The IUPAC name of 5-bromo-2-(methoxymethyl)-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxine (CID 118021303) is 5-bromo-2-(methoxymethyl)-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxine.
What is the SMILES notation for 5-bromo-2-(methoxymethyl)-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxine?
The canonical SMILES for 5-bromo-2-(methoxymethyl)-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxine is COCC1COc2c(Br)cc(S(C)(=O)=O)cc2O1.
What is the InChIKey of 5-bromo-2-(methoxymethyl)-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxine?
The InChIKey is XAIYDNAGQAPOHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO5S/c1-15-5-7-6-16-11-9(12)3-8(18(2,13)14)4-10(11)17-7/h3-4,7H,5-6H2,1-2H3.
What are the key properties of 5-bromo-2-(methoxymethyl)-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxine?
5-bromo-2-(methoxymethyl)-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxine has a molecular weight of 337.19 g/mol, XLogP of 1.64, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(methoxymethyl)-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxine is sourced from PubChem (CID 118021303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).