About 4-bromo-2-methyl-5,6,7,8-tetrahydroisoquinolin-1-one
4-bromo-2-methyl-5,6,7,8-tetrahydroisoquinolin-1-one (PubChem CID 118021767) has the molecular formula C10H12BrNO
and a molecular weight of 242.12 g/mol. Its IUPAC name is 4-bromo-2-methyl-5,6,7,8-tetrahydroisoquinolin-1-one.
Molecular Properties
| Compound Name | 4-bromo-2-methyl-5,6,7,8-tetrahydroisoquinolin-1-one |
| PubChem CID | 118021767 |
| Molecular Formula | C10H12BrNO |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 4-bromo-2-methyl-5,6,7,8-tetrahydroisoquinolin-1-one |
| SMILES | Cn1cc(Br)c2c(c1=O)CCCC2 |
| InChI | InChI=1S/C10H12BrNO/c1-12-6-9(11)7-4-2-3-5-8(7)10(12)13/h6H,2-5H2,1H3 |
| InChIKey | KOXKTWXQQGHROI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2-methyl-5,6,7,8-tetrahydroisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-methyl-5,6,7,8-tetrahydroisoquinolin-1-one?
The IUPAC name of 4-bromo-2-methyl-5,6,7,8-tetrahydroisoquinolin-1-one (CID 118021767) is 4-bromo-2-methyl-5,6,7,8-tetrahydroisoquinolin-1-one.
What is the SMILES notation for 4-bromo-2-methyl-5,6,7,8-tetrahydroisoquinolin-1-one?
The canonical SMILES for 4-bromo-2-methyl-5,6,7,8-tetrahydroisoquinolin-1-one is Cn1cc(Br)c2c(c1=O)CCCC2.
What is the InChIKey of 4-bromo-2-methyl-5,6,7,8-tetrahydroisoquinolin-1-one?
The InChIKey is KOXKTWXQQGHROI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNO/c1-12-6-9(11)7-4-2-3-5-8(7)10(12)13/h6H,2-5H2,1H3.
What are the key properties of 4-bromo-2-methyl-5,6,7,8-tetrahydroisoquinolin-1-one?
4-bromo-2-methyl-5,6,7,8-tetrahydroisoquinolin-1-one has a molecular weight of 242.12 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-methyl-5,6,7,8-tetrahydroisoquinolin-1-one is sourced from PubChem (CID 118021767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).