C26H30ClF3N6O2 — CID 118021907
[4-chloro-2-methoxy-3-[(4,4,4-trifluorobutylamino)methyl]quinolin-6-yl]-bis(2,3-dimethylimidazol-4-yl)methanol (PubChem CID 118021907) has the molecular formula C26H30ClF3N6O2 and a molecular weight of 551.01 g/mol. Its IUPAC name is [4-chloro-2-methoxy-3-[(4,4,4-trifluorobutylamino)methyl]quinolin-6-yl]-bis(2,3-dimethylimidazol-4-yl)methanol.
| Compound Name | [4-chloro-2-methoxy-3-[(4,4,4-trifluorobutylamino)methyl]quinolin-6-yl]-bis(2,3-dimethylimidazol-4-yl)methanol |
|---|---|
| PubChem CID | 118021907 |
| Molecular Formula | C26H30ClF3N6O2 |
| Molecular Weight | 551.01 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | [4-chloro-2-methoxy-3-[(4,4,4-trifluorobutylamino)methyl]quinolin-6-yl]-bis(2,3-dimethylimidazol-4-yl)methanol |
| SMILES | COc1nc2ccc(C(O)(c3cnc(C)n3C)c3cnc(C)n3C)cc2c(Cl)c1CNCCCC(F)(F)F |
| InChI | InChI=1S/C26H30ClF3N6O2/c1-15-32-13-21(35(15)3)26(37,22-14-33-16(2)36(22)4)17-7-8-20-18(11-17)23(27)19(24(34-20)38-5)12-31-10-6-9-25(28,29)30/h7-8,11,13-14,31,37H,6,9-10,12H2,1-5H3 |
| InChIKey | QHIAICJHEWUZDP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.01 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|