About (4-fluorophenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate
(4-fluorophenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 1180220) has the molecular formula C17H11FN2O6
and a molecular weight of 358.28 g/mol. Its IUPAC name is (4-fluorophenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate.
Molecular Properties
| Compound Name | (4-fluorophenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
| PubChem CID | 1180220 |
| Molecular Formula | C17H11FN2O6 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | (4-fluorophenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(CCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C17H11FN2O6/c18-10-4-6-11(7-5-10)26-14(21)8-9-19-16(22)12-2-1-3-13(20(24)25)15(12)17(19)23/h1-7H,8-9H2 |
| InChIKey | NQFUDPLJNXNPAP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate?
The IUPAC name of (4-fluorophenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate (CID 1180220) is (4-fluorophenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate.
What is the SMILES notation for (4-fluorophenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate?
The canonical SMILES for (4-fluorophenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate is O=C(CCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Oc1ccc(F)cc1.
What is the InChIKey of (4-fluorophenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate?
The InChIKey is NQFUDPLJNXNPAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11FN2O6/c18-10-4-6-11(7-5-10)26-14(21)8-9-19-16(22)12-2-1-3-13(20(24)25)15(12)17(19)23/h1-7H,8-9H2.
What are the key properties of (4-fluorophenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate?
(4-fluorophenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate has a molecular weight of 358.28 g/mol, XLogP of 2.33, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate is sourced from PubChem (CID 1180220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).