C21H29F2N5O4S — CID 118022048
(2S)-N-[(7R)-5-[1-(difluoromethyl)-3-methylpyrazol-4-yl]sulfonyl-7-(hydroxymethyl)-7,8-dihydro-6H-1,5-naphthyridin-3-yl]-2,3,3-trimethylbutanamide (PubChem CID 118022048) has the molecular formula C21H29F2N5O4S and a molecular weight of 485.56 g/mol. Its IUPAC name is (2S)-N-[(7R)-5-[1-(difluoromethyl)-3-methylpyrazol-4-yl]sulfonyl-7-(hydroxymethyl)-7,8-dihydro-6H-1,5-naphthyridin-3-yl]-2,3,3-trimethylbutanamide.
| Compound Name | (2S)-N-[(7R)-5-[1-(difluoromethyl)-3-methylpyrazol-4-yl]sulfonyl-7-(hydroxymethyl)-7,8-dihydro-6H-1,5-naphthyridin-3-yl]-2,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 118022048 |
| Molecular Formula | C21H29F2N5O4S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | (2S)-N-[(7R)-5-[1-(difluoromethyl)-3-methylpyrazol-4-yl]sulfonyl-7-(hydroxymethyl)-7,8-dihydro-6H-1,5-naphthyridin-3-yl]-2,3,3-trimethylbutanamide |
| SMILES | Cc1nn(C(F)F)cc1S(=O)(=O)N1C[C@H](CO)Cc2ncc(NC(=O)[C@@H](C)C(C)(C)C)cc21 |
| InChI | InChI=1S/C21H29F2N5O4S/c1-12(21(3,4)5)19(30)25-15-7-17-16(24-8-15)6-14(11-29)9-28(17)33(31,32)18-10-27(20(22)23)26-13(18)2/h7-8,10,12,14,20,29H,6,9,11H2,1-5H3,(H,25,30)/t12-,14-/m1/s1 |
| InChIKey | YHSYFKUIXIFNDB-TZMCWYRMSA-N |
| XLogP | 2.96 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |