About 2-fluoro-7-methoxyfuro[2,3-c]pyridine
2-fluoro-7-methoxyfuro[2,3-c]pyridine (PubChem CID 118022446) has the molecular formula C8H6FNO2
and a molecular weight of 167.14 g/mol. Its IUPAC name is 2-fluoro-7-methoxyfuro[2,3-c]pyridine.
Molecular Properties
| Compound Name | 2-fluoro-7-methoxyfuro[2,3-c]pyridine |
| PubChem CID | 118022446 |
| Molecular Formula | C8H6FNO2 |
| Molecular Weight | 167.14 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 2-fluoro-7-methoxyfuro[2,3-c]pyridine |
| SMILES | COc1nccc2cc(F)oc12 |
| InChI | InChI=1S/C8H6FNO2/c1-11-8-7-5(2-3-10-8)4-6(9)12-7/h2-4H,1H3 |
| InChIKey | YCODAYVWUBZHOI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.14 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-7-methoxyfuro[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-7-methoxyfuro[2,3-c]pyridine?
The IUPAC name of 2-fluoro-7-methoxyfuro[2,3-c]pyridine (CID 118022446) is 2-fluoro-7-methoxyfuro[2,3-c]pyridine.
What is the SMILES notation for 2-fluoro-7-methoxyfuro[2,3-c]pyridine?
The canonical SMILES for 2-fluoro-7-methoxyfuro[2,3-c]pyridine is COc1nccc2cc(F)oc12.
What is the InChIKey of 2-fluoro-7-methoxyfuro[2,3-c]pyridine?
The InChIKey is YCODAYVWUBZHOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FNO2/c1-11-8-7-5(2-3-10-8)4-6(9)12-7/h2-4H,1H3.
What are the key properties of 2-fluoro-7-methoxyfuro[2,3-c]pyridine?
2-fluoro-7-methoxyfuro[2,3-c]pyridine has a molecular weight of 167.14 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-7-methoxyfuro[2,3-c]pyridine is sourced from PubChem (CID 118022446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).