About (3-chlorophenyl)-(2,4-dichloro-3-propan-2-ylquinolin-6-yl)-pyridin-3-ylmethanol
(3-chlorophenyl)-(2,4-dichloro-3-propan-2-ylquinolin-6-yl)-pyridin-3-ylmethanol (PubChem CID 118022497) has the molecular formula C24H19Cl3N2O
and a molecular weight of 457.79 g/mol. Its IUPAC name is (3-chlorophenyl)-(2,4-dichloro-3-propan-2-ylquinolin-6-yl)-pyridin-3-ylmethanol.
Molecular Properties
| Compound Name | (3-chlorophenyl)-(2,4-dichloro-3-propan-2-ylquinolin-6-yl)-pyridin-3-ylmethanol |
| PubChem CID | 118022497 |
| Molecular Formula | C24H19Cl3N2O |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | (3-chlorophenyl)-(2,4-dichloro-3-propan-2-ylquinolin-6-yl)-pyridin-3-ylmethanol |
| SMILES | CC(C)c1c(Cl)nc2ccc(C(O)(c3cccnc3)c3cccc(Cl)c3)cc2c1Cl |
| InChI | InChI=1S/C24H19Cl3N2O/c1-14(2)21-22(26)19-12-16(8-9-20(19)29-23(21)27)24(30,17-6-4-10-28-13-17)15-5-3-7-18(25)11-15/h3-14,30H,1-2H3 |
| InChIKey | RCZLGRMBRSAZSB-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (3-chlorophenyl)-(2,4-dichloro-3-propan-2-ylquinolin-6-yl)-pyridin-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)-(2,4-dichloro-3-propan-2-ylquinolin-6-yl)-pyridin-3-ylmethanol?
The IUPAC name of (3-chlorophenyl)-(2,4-dichloro-3-propan-2-ylquinolin-6-yl)-pyridin-3-ylmethanol (CID 118022497) is (3-chlorophenyl)-(2,4-dichloro-3-propan-2-ylquinolin-6-yl)-pyridin-3-ylmethanol.
What is the SMILES notation for (3-chlorophenyl)-(2,4-dichloro-3-propan-2-ylquinolin-6-yl)-pyridin-3-ylmethanol?
The canonical SMILES for (3-chlorophenyl)-(2,4-dichloro-3-propan-2-ylquinolin-6-yl)-pyridin-3-ylmethanol is CC(C)c1c(Cl)nc2ccc(C(O)(c3cccnc3)c3cccc(Cl)c3)cc2c1Cl.
What is the InChIKey of (3-chlorophenyl)-(2,4-dichloro-3-propan-2-ylquinolin-6-yl)-pyridin-3-ylmethanol?
The InChIKey is RCZLGRMBRSAZSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19Cl3N2O/c1-14(2)21-22(26)19-12-16(8-9-20(19)29-23(21)27)24(30,17-6-4-10-28-13-17)15-5-3-7-18(25)11-15/h3-14,30H,1-2H3.
What are the key properties of (3-chlorophenyl)-(2,4-dichloro-3-propan-2-ylquinolin-6-yl)-pyridin-3-ylmethanol?
(3-chlorophenyl)-(2,4-dichloro-3-propan-2-ylquinolin-6-yl)-pyridin-3-ylmethanol has a molecular weight of 457.79 g/mol, XLogP of 7.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)-(2,4-dichloro-3-propan-2-ylquinolin-6-yl)-pyridin-3-ylmethanol is sourced from PubChem (CID 118022497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).