C22H20Cl2F3N5O — CID 118022863
[2,4-dichloro-3-(2,2,2-trifluoroethyl)quinolin-6-yl]-bis(2,3-dimethylimidazol-4-yl)methanol (PubChem CID 118022863) has the molecular formula C22H20Cl2F3N5O and a molecular weight of 498.34 g/mol. Its IUPAC name is [2,4-dichloro-3-(2,2,2-trifluoroethyl)quinolin-6-yl]-bis(2,3-dimethylimidazol-4-yl)methanol.
| Compound Name | [2,4-dichloro-3-(2,2,2-trifluoroethyl)quinolin-6-yl]-bis(2,3-dimethylimidazol-4-yl)methanol |
|---|---|
| PubChem CID | 118022863 |
| Molecular Formula | C22H20Cl2F3N5O |
| Molecular Weight | 498.34 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | [2,4-dichloro-3-(2,2,2-trifluoroethyl)quinolin-6-yl]-bis(2,3-dimethylimidazol-4-yl)methanol |
| SMILES | Cc1ncc(C(O)(c2ccc3nc(Cl)c(CC(F)(F)F)c(Cl)c3c2)c2cnc(C)n2C)n1C |
| InChI | InChI=1S/C22H20Cl2F3N5O/c1-11-28-9-17(31(11)3)22(33,18-10-29-12(2)32(18)4)13-5-6-16-14(7-13)19(23)15(20(24)30-16)8-21(25,26)27/h5-7,9-10,33H,8H2,1-4H3 |
| InChIKey | GCVXNIBJGDHPEO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|