C25H26ClF3N6O — CID 118022895
[4-(azetidin-1-yl)-2-chloro-3-(2,2,2-trifluoroethyl)quinolin-6-yl]-bis(2,3-dimethylimidazol-4-yl)methanol (PubChem CID 118022895) has the molecular formula C25H26ClF3N6O and a molecular weight of 518.97 g/mol. Its IUPAC name is [4-(azetidin-1-yl)-2-chloro-3-(2,2,2-trifluoroethyl)quinolin-6-yl]-bis(2,3-dimethylimidazol-4-yl)methanol.
| Compound Name | [4-(azetidin-1-yl)-2-chloro-3-(2,2,2-trifluoroethyl)quinolin-6-yl]-bis(2,3-dimethylimidazol-4-yl)methanol |
|---|---|
| PubChem CID | 118022895 |
| Molecular Formula | C25H26ClF3N6O |
| Molecular Weight | 518.97 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | [4-(azetidin-1-yl)-2-chloro-3-(2,2,2-trifluoroethyl)quinolin-6-yl]-bis(2,3-dimethylimidazol-4-yl)methanol |
| SMILES | Cc1ncc(C(O)(c2ccc3nc(Cl)c(CC(F)(F)F)c(N4CCC4)c3c2)c2cnc(C)n2C)n1C |
| InChI | InChI=1S/C25H26ClF3N6O/c1-14-30-12-20(33(14)3)25(36,21-13-31-15(2)34(21)4)16-6-7-19-17(10-16)22(35-8-5-9-35)18(23(26)32-19)11-24(27,28)29/h6-7,10,12-13,36H,5,8-9,11H2,1-4H3 |
| InChIKey | SIDZOLLDYLFXSL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.97 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|