C30H39F5N4O6 — CID 11802328
1-[(2S)-3-methyl-2-[[4-(morpholine-4-carbonyl)benzoyl]amino]butanoyl]-N-(5,5,6,6,6-pentafluoro-2-methyl-4-oxohexan-3-yl)piperidine-2-carboxamide (PubChem CID 11802328) has the molecular formula C30H39F5N4O6 and a molecular weight of 646.65 g/mol. Its IUPAC name is 1-[(2S)-3-methyl-2-[[4-(morpholine-4-carbonyl)benzoyl]amino]butanoyl]-N-(5,5,6,6,6-pentafluoro-2-methyl-4-oxohexan-3-yl)piperidine-2-carboxamide.
| Compound Name | 1-[(2S)-3-methyl-2-[[4-(morpholine-4-carbonyl)benzoyl]amino]butanoyl]-N-(5,5,6,6,6-pentafluoro-2-methyl-4-oxohexan-3-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 11802328 |
| Molecular Formula | C30H39F5N4O6 |
| Molecular Weight | 646.65 g/mol |
| Exact Mass | 646.28 |
| IUPAC Name | 1-[(2S)-3-methyl-2-[[4-(morpholine-4-carbonyl)benzoyl]amino]butanoyl]-N-(5,5,6,6,6-pentafluoro-2-methyl-4-oxohexan-3-yl)piperidine-2-carboxamide |
| SMILES | CC(C)C(NC(=O)C1CCCCN1C(=O)[C@@H](NC(=O)c1ccc(C(=O)N2CCOCC2)cc1)C(C)C)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C30H39F5N4O6/c1-17(2)22(24(40)29(31,32)30(33,34)35)36-26(42)21-7-5-6-12-39(21)28(44)23(18(3)4)37-25(41)19-8-10-20(11-9-19)27(43)38-13-15-45-16-14-38/h8-11,17-18,21-23H,5-7,12-16H2,1-4H3,(H,36,42)(H,37,41)/t21?,22?,23-/m0/s1 |
| InChIKey | ZKYHPNVSPSJNRY-VNXZQDSDSA-N |
| XLogP | 3.20 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.65 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|