C16H15ClF3N5O2 — CID 118023317
(E)-N-[2-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-2-oxoethyl]-4,4,4-trifluorobut-2-enamide (PubChem CID 118023317) has the molecular formula C16H15ClF3N5O2 and a molecular weight of 401.78 g/mol. Its IUPAC name is (E)-N-[2-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-2-oxoethyl]-4,4,4-trifluorobut-2-enamide.
| Compound Name | (E)-N-[2-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-2-oxoethyl]-4,4,4-trifluorobut-2-enamide |
|---|---|
| PubChem CID | 118023317 |
| Molecular Formula | C16H15ClF3N5O2 |
| Molecular Weight | 401.78 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | (E)-N-[2-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-2-oxoethyl]-4,4,4-trifluorobut-2-enamide |
| SMILES | CCN(C(=O)CNC(=O)/C=C/C(F)(F)F)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C16H15ClF3N5O2/c1-2-24(14(27)9-22-13(26)5-6-16(18,19)20)12-10-25(23-15(12)17)11-4-3-7-21-8-11/h3-8,10H,2,9H2,1H3,(H,22,26)/b6-5+ |
| InChIKey | ODRITNCBDUSPEI-AATRIKPKSA-N |
| XLogP | 2.51 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|