C9H12N2 — CID 118023477
2,3,4,5-tetrahydro-1H-pyrido[3,2-b]azepine (PubChem CID 118023477) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1H-pyrido[3,2-b]azepine.
| Compound Name | 2,3,4,5-tetrahydro-1H-pyrido[3,2-b]azepine |
|---|---|
| PubChem CID | 118023477 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2,3,4,5-tetrahydro-1H-pyrido[3,2-b]azepine |
| SMILES | C1=CNC2=C(C=C1)NCCC2 |
| InChI | InChI=1S/C9H12N2/c1-2-6-10-9-5-3-7-11-8(9)4-1/h1-2,4,6,10-11H,3,5,7H2 |
| InChIKey | KCHIOARXGPIAPG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |