C23H27FN6O3S — CID 118023484
N-[1-[(3S,4R)-4-benzyl-7-fluoro-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-1-methyltriazole-4-sulfonamide (PubChem CID 118023484) has the molecular formula C23H27FN6O3S and a molecular weight of 486.57 g/mol. Its IUPAC name is N-[1-[(3S,4R)-4-benzyl-7-fluoro-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-1-methyltriazole-4-sulfonamide.
| Compound Name | N-[1-[(3S,4R)-4-benzyl-7-fluoro-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-1-methyltriazole-4-sulfonamide |
|---|---|
| PubChem CID | 118023484 |
| Molecular Formula | C23H27FN6O3S |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | N-[1-[(3S,4R)-4-benzyl-7-fluoro-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-1-methyltriazole-4-sulfonamide |
| SMILES | CN[C@@H]1COc2cc(F)c(N3CC(NS(=O)(=O)c4cn(C)nn4)C3)cc2[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H27FN6O3S/c1-25-20-14-33-22-10-19(24)21(9-18(22)17(20)8-15-6-4-3-5-7-15)30-11-16(12-30)27-34(31,32)23-13-29(2)28-26-23/h3-7,9-10,13,16-17,20,25,27H,8,11-12,14H2,1-2H3/t17-,20-/m1/s1 |
| InChIKey | WDXXPFPELAASII-YLJYHZDGSA-N |
| XLogP | 1.43 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|