C27H24ClN7O — CID 118023698
3-[[5-chloro-1-(3-methylbutyl)imidazo[4,5-b]pyridin-2-yl]methyl]-1-quinolin-6-ylimidazo[4,5-c]pyridin-2-one (PubChem CID 118023698) has the molecular formula C27H24ClN7O and a molecular weight of 497.99 g/mol. Its IUPAC name is 3-[[5-chloro-1-(3-methylbutyl)imidazo[4,5-b]pyridin-2-yl]methyl]-1-quinolin-6-ylimidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-[[5-chloro-1-(3-methylbutyl)imidazo[4,5-b]pyridin-2-yl]methyl]-1-quinolin-6-ylimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 118023698 |
| Molecular Formula | C27H24ClN7O |
| Molecular Weight | 497.99 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 3-[[5-chloro-1-(3-methylbutyl)imidazo[4,5-b]pyridin-2-yl]methyl]-1-quinolin-6-ylimidazo[4,5-c]pyridin-2-one |
| SMILES | CC(C)CCn1c(Cn2c(=O)n(-c3ccc4ncccc4c3)c3ccncc32)nc2nc(Cl)ccc21 |
| InChI | InChI=1S/C27H24ClN7O/c1-17(2)10-13-33-22-7-8-24(28)31-26(22)32-25(33)16-34-23-15-29-12-9-21(23)35(27(34)36)19-5-6-20-18(14-19)4-3-11-30-20/h3-9,11-12,14-15,17H,10,13,16H2,1-2H3 |
| InChIKey | BJVWMZGXNIZCAS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.99 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|