C27H28F2N4O3S — CID 118023788
N-[1-[(3S,4S)-3-(azetidin-1-yl)-4-benzyl-7-fluoro-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-2-fluoropyridine-3-sulfonamide (PubChem CID 118023788) has the molecular formula C27H28F2N4O3S and a molecular weight of 526.61 g/mol. Its IUPAC name is N-[1-[(3S,4S)-3-(azetidin-1-yl)-4-benzyl-7-fluoro-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-2-fluoropyridine-3-sulfonamide.
| Compound Name | N-[1-[(3S,4S)-3-(azetidin-1-yl)-4-benzyl-7-fluoro-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-2-fluoropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 118023788 |
| Molecular Formula | C27H28F2N4O3S |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | N-[1-[(3S,4S)-3-(azetidin-1-yl)-4-benzyl-7-fluoro-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-2-fluoropyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC1CN(c2cc3c(cc2F)OC[C@@H](N2CCC2)[C@H]3Cc2ccccc2)C1)c1cccnc1F |
| InChI | InChI=1S/C27H28F2N4O3S/c28-22-14-25-21(20(12-18-6-2-1-3-7-18)24(17-36-25)32-10-5-11-32)13-23(22)33-15-19(16-33)31-37(34,35)26-8-4-9-30-27(26)29/h1-4,6-9,13-14,19-20,24,31H,5,10-12,15-17H2/t20-,24+/m0/s1 |
| InChIKey | SBVQXGKVNZWASD-GBXCKJPGSA-N |
| XLogP | 3.32 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|