C16H19Cl2N3O — CID 118024025
N-(4,6-dichloro-2-methylpyrimidin-5-yl)adamantane-1-carboxamide (PubChem CID 118024025) has the molecular formula C16H19Cl2N3O and a molecular weight of 340.25 g/mol. Its IUPAC name is N-(4,6-dichloro-2-methylpyrimidin-5-yl)adamantane-1-carboxamide.
| Compound Name | N-(4,6-dichloro-2-methylpyrimidin-5-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 118024025 |
| Molecular Formula | C16H19Cl2N3O |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-(4,6-dichloro-2-methylpyrimidin-5-yl)adamantane-1-carboxamide |
| SMILES | Cc1nc(Cl)c(NC(=O)C23CC4CC(CC(C4)C2)C3)c(Cl)n1 |
| InChI | InChI=1S/C16H19Cl2N3O/c1-8-19-13(17)12(14(18)20-8)21-15(22)16-5-9-2-10(6-16)4-11(3-9)7-16/h9-11H,2-7H2,1H3,(H,21,22) |
| InChIKey | NPSCKBNRXNQNTC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |