C16H14ClF3N4OS2 — CID 118024108
N-(4-chloro-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-N-prop-2-ynyl-3-(3,3,3-trifluoropropylsulfanyl)propanamide (PubChem CID 118024108) has the molecular formula C16H14ClF3N4OS2 and a molecular weight of 434.90 g/mol. Its IUPAC name is N-(4-chloro-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-N-prop-2-ynyl-3-(3,3,3-trifluoropropylsulfanyl)propanamide.
| Compound Name | N-(4-chloro-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-N-prop-2-ynyl-3-(3,3,3-trifluoropropylsulfanyl)propanamide |
|---|---|
| PubChem CID | 118024108 |
| Molecular Formula | C16H14ClF3N4OS2 |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | N-(4-chloro-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-N-prop-2-ynyl-3-(3,3,3-trifluoropropylsulfanyl)propanamide |
| SMILES | C#CCN(C(=O)CCSCCC(F)(F)F)c1sc(-c2cncnc2)nc1Cl |
| InChI | InChI=1S/C16H14ClF3N4OS2/c1-2-5-24(12(25)3-6-26-7-4-16(18,19)20)15-13(17)23-14(27-15)11-8-21-10-22-9-11/h1,8-10H,3-7H2 |
| InChIKey | YWMYKPPVYMFWDR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|