C7H14O8S — CID 118024182
[(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] methanesulfonate (PubChem CID 118024182) has the molecular formula C7H14O8S and a molecular weight of 258.25 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] methanesulfonate.
| Compound Name | [(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] methanesulfonate |
|---|---|
| PubChem CID | 118024182 |
| Molecular Formula | C7H14O8S |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | [(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C7H14O8S/c1-16(13,14)15-3-5(10)7(12)6(11)4(9)2-8/h2,4-7,9-12H,3H2,1H3/t4-,5+,6+,7-/m0/s1 |
| InChIKey | NGFBWCCWRRVFQV-WNJXEPBRSA-N |
| XLogP | -3.39 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|