C14H7F17N2O4S2 — CID 11802422
4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)benzenesulfonamide (PubChem CID 11802422) has the molecular formula C14H7F17N2O4S2 and a molecular weight of 654.32 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)benzenesulfonamide.
| Compound Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 11802422 |
| Molecular Formula | C14H7F17N2O4S2 |
| Molecular Weight | 654.32 g/mol |
| Exact Mass | 653.96 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H7F17N2O4S2/c15-7(16,9(19,20)11(23,24)13(27,28)29)8(17,18)10(21,22)12(25,26)14(30,31)39(36,37)33-5-1-3-6(4-2-5)38(32,34)35/h1-4,33H,(H2,32,34,35) |
| InChIKey | ZBJQDRBIVLWHSI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.32 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|