C32H29N7O3S — CID 118025123
4-amino-N-[(1S,3R)-3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-cyanopyrimidin-2-yl]amino]cyclohexyl]benzamide (PubChem CID 118025123) has the molecular formula C32H29N7O3S and a molecular weight of 591.70 g/mol. Its IUPAC name is 4-amino-N-[(1S,3R)-3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-cyanopyrimidin-2-yl]amino]cyclohexyl]benzamide.
| Compound Name | 4-amino-N-[(1S,3R)-3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-cyanopyrimidin-2-yl]amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 118025123 |
| Molecular Formula | C32H29N7O3S |
| Molecular Weight | 591.70 g/mol |
| Exact Mass | 591.21 |
| IUPAC Name | 4-amino-N-[(1S,3R)-3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-cyanopyrimidin-2-yl]amino]cyclohexyl]benzamide |
| SMILES | N#Cc1cnc(N[C@@H]2CCC[C@H](NC(=O)c3ccc(N)cc3)C2)nc1-c1cn(S(=O)(=O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C32H29N7O3S/c33-18-22-19-35-32(37-25-8-6-7-24(17-25)36-31(40)21-13-15-23(34)16-14-21)38-30(22)28-20-39(29-12-5-4-11-27(28)29)43(41,42)26-9-2-1-3-10-26/h1-5,9-16,19-20,24-25H,6-8,17,34H2,(H,36,40)(H,35,37,38)/t24-,25+/m0/s1 |
| InChIKey | KJRSKEDYPYQODX-LOSJGSFVSA-N |
| XLogP | 4.94 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.70 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|