C24H25ClN6O2S — CID 118025250
4-amino-N-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]benzenesulfonamide (PubChem CID 118025250) has the molecular formula C24H25ClN6O2S and a molecular weight of 497.02 g/mol. Its IUPAC name is 4-amino-N-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]benzenesulfonamide.
| Compound Name | 4-amino-N-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 118025250 |
| Molecular Formula | C24H25ClN6O2S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 4-amino-N-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)N[C@H]2CCC[C@@H](Nc3ncc(Cl)c(-c4c[nH]c5ccccc45)n3)C2)cc1 |
| InChI | InChI=1S/C24H25ClN6O2S/c25-21-14-28-24(30-23(21)20-13-27-22-7-2-1-6-19(20)22)29-16-4-3-5-17(12-16)31-34(32,33)18-10-8-15(26)9-11-18/h1-2,6-11,13-14,16-17,27,31H,3-5,12,26H2,(H,28,29,30)/t16-,17+/m1/s1 |
| InChIKey | UYUDYMJBJFQBEA-SJORKVTESA-N |
| XLogP | 4.56 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|