C27H32ClN5O5 — CID 118025356
1-O-tert-butyl 3-O-(2-methylpropanoyl) 5-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]piperidine-1,3-dicarboxylate (PubChem CID 118025356) has the molecular formula C27H32ClN5O5 and a molecular weight of 542.04 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-(2-methylpropanoyl) 5-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-(2-methylpropanoyl) 5-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 118025356 |
| Molecular Formula | C27H32ClN5O5 |
| Molecular Weight | 542.04 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 1-O-tert-butyl 3-O-(2-methylpropanoyl) 5-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]piperidine-1,3-dicarboxylate |
| SMILES | CC(C)C(=O)OC(=O)C1CC(Nc2ncc(Cl)c(-c3c[nH]c4ccccc34)n2)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C27H32ClN5O5/c1-15(2)23(34)37-24(35)16-10-17(14-33(13-16)26(36)38-27(3,4)5)31-25-30-12-20(28)22(32-25)19-11-29-21-9-7-6-8-18(19)21/h6-9,11-12,15-17,29H,10,13-14H2,1-5H3,(H,30,31,32) |
| InChIKey | XQMCTGSGVPFLLS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.04 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|