C32H34ClN7O4 — CID 118025402
tert-butyl 3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-5-[[4-(prop-2-enoylamino)phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 118025402) has the molecular formula C32H34ClN7O4 and a molecular weight of 616.12 g/mol. Its IUPAC name is tert-butyl 3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-5-[[4-(prop-2-enoylamino)phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-5-[[4-(prop-2-enoylamino)phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118025402 |
| Molecular Formula | C32H34ClN7O4 |
| Molecular Weight | 616.12 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | tert-butyl 3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-5-[[4-(prop-2-enoylamino)phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | C=CC(=O)Nc1ccc(NC(=O)C2CC(Nc3ncc(Cl)c(-c4c[nH]c5ccccc45)n3)CN(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C32H34ClN7O4/c1-5-27(41)36-20-10-12-21(13-11-20)37-29(42)19-14-22(18-40(17-19)31(43)44-32(2,3)4)38-30-35-16-25(33)28(39-30)24-15-34-26-9-7-6-8-23(24)26/h5-13,15-16,19,22,34H,1,14,17-18H2,2-4H3,(H,36,41)(H,37,42)(H,35,38,39) |
| InChIKey | WERGERCCOCUFBG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.12 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|